C18H34OSi — CID 5365996
trimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane (PubChem CID 5365996) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is trimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane.
| Compound Name | trimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
|---|---|
| PubChem CID | 5365996 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | trimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO[Si](C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-19-20(5,6)7/h10,12,14H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+ |
| InChIKey | WMPDMQCCFFSRIM-NXGXIAAHSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|