C20H38OSi2 — CID 134982724
tert-butyl-[(2R,3E,5E)-4-ethyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane (PubChem CID 134982724) has the molecular formula C20H38OSi2 and a molecular weight of 350.70 g/mol. Its IUPAC name is tert-butyl-[(2R,3E,5E)-4-ethyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3E,5E)-4-ethyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134982724 |
| Molecular Formula | C20H38OSi2 |
| Molecular Weight | 350.70 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | tert-butyl-[(2R,3E,5E)-4-ethyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
| SMILES | CCC(/C=C/C#C[Si](C)(C)C)=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38OSi2/c1-11-19(14-12-13-15-22(6,7)8)16-18(2)17-21-23(9,10)20(3,4)5/h12,14,16,18H,11,17H2,1-10H3/b14-12+,19-16+/t18-/m1/s1 |
| InChIKey | AWASKOGIFOOVKS-NLKRLBMYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.70 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|