C15H30OSi — CID 11594048
tert-butyl-[(2S,3Z)-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane (PubChem CID 11594048) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is tert-butyl-[(2S,3Z)-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3Z)-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11594048 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tert-butyl-[(2S,3Z)-2,4-dimethylhepta-3,6-dienoxy]-dimethylsilane |
| SMILES | C=CC/C(C)=C\[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-9-10-13(2)11-14(3)12-16-17(7,8)15(4,5)6/h9,11,14H,1,10,12H2,2-8H3/b13-11-/t14-/m0/s1 |
| InChIKey | WUAHKXRUSJMWKA-FZDNWWAKSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|