C17H32OSi — CID 15174762
(2-methylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane (PubChem CID 15174762) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is (2-methylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane.
| Compound Name | (2-methylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15174762 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (2-methylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
| SMILES | CC1=CC=CCC1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32OSi/c1-13(2)19(14(3)4,15(5)6)18-12-17-11-9-8-10-16(17)7/h8-10,13-15,17H,11-12H2,1-7H3 |
| InChIKey | XTEVKJBXBJQCBC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|