C15H28Br2OSi — CID 46218442
tert-butyl-[(2E)-9,9-dibromonona-2,8-dienoxy]-dimethylsilane (PubChem CID 46218442) has the molecular formula C15H28Br2OSi and a molecular weight of 412.28 g/mol. Its IUPAC name is tert-butyl-[(2E)-9,9-dibromonona-2,8-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E)-9,9-dibromonona-2,8-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 46218442 |
| Molecular Formula | C15H28Br2OSi |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | tert-butyl-[(2E)-9,9-dibromonona-2,8-dienoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/CCCCC=C(Br)Br |
| InChI | InChI=1S/C15H28Br2OSi/c1-15(2,3)19(4,5)18-13-11-9-7-6-8-10-12-14(16)17/h9,11-12H,6-8,10,13H2,1-5H3/b11-9+ |
| InChIKey | ICDIPCJRVCXLPT-PKNBQFBNSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|