C20H37BrOSi — CID 71492006
[(4S,5E)-2-(bromomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]oxy-triethylsilane (PubChem CID 71492006) has the molecular formula C20H37BrOSi and a molecular weight of 401.51 g/mol. Its IUPAC name is [(4S,5E)-2-(bromomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]oxy-triethylsilane.
| Compound Name | [(4S,5E)-2-(bromomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71492006 |
| Molecular Formula | C20H37BrOSi |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(4S,5E)-2-(bromomethyl)-6,10-dimethylundeca-1,5,10-trien-4-yl]oxy-triethylsilane |
| SMILES | C=C(C)CCC/C(C)=C/[C@H](CC(=C)CBr)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H37BrOSi/c1-8-23(9-2,10-3)22-20(15-19(7)16-21)14-18(6)13-11-12-17(4)5/h14,20H,4,7-13,15-16H2,1-3,5-6H3/b18-14+/t20-/m1/s1 |
| InChIKey | GOQFAJIAVFCZNG-WORNYLJVSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|