C15H31BrOSi — CID 87228551
[(E)-1-bromonon-2-en-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 87228551) has the molecular formula C15H31BrOSi and a molecular weight of 335.40 g/mol. Its IUPAC name is [(E)-1-bromonon-2-en-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E)-1-bromonon-2-en-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 87228551 |
| Molecular Formula | C15H31BrOSi |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [(E)-1-bromonon-2-en-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCC(/C=C/CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H31BrOSi/c1-7-8-9-11-14(12-10-13-16)17-18(5,6)15(2,3)4/h10,12,14H,7-9,11,13H2,1-6H3/b12-10+ |
| InChIKey | WIDJSWAOMJJQDJ-ZRDIBKRKSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|