C17H30OSi — CID 10516758
(6E)-2,6-dimethyl-12-trimethylsilyldodeca-1,6-dien-10-yn-3-ol (PubChem CID 10516758) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-12-trimethylsilyldodeca-1,6-dien-10-yn-3-ol.
| Compound Name | (6E)-2,6-dimethyl-12-trimethylsilyldodeca-1,6-dien-10-yn-3-ol |
|---|---|
| PubChem CID | 10516758 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (6E)-2,6-dimethyl-12-trimethylsilyldodeca-1,6-dien-10-yn-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/CCC#CC[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-15(2)17(18)13-12-16(3)11-9-7-8-10-14-19(4,5)6/h11,17-18H,1,7,9,12-14H2,2-6H3/b16-11+ |
| InChIKey | UFBARBRZPFYGCU-LFIBNONCSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|