C17H26OSi — CID 134897048
4-methyl-1-(2-prop-1-ynylcyclopenten-1-yl)-4-trimethylsilylpent-2-yn-1-ol (PubChem CID 134897048) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is 4-methyl-1-(2-prop-1-ynylcyclopenten-1-yl)-4-trimethylsilylpent-2-yn-1-ol.
| Compound Name | 4-methyl-1-(2-prop-1-ynylcyclopenten-1-yl)-4-trimethylsilylpent-2-yn-1-ol |
|---|---|
| PubChem CID | 134897048 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4-methyl-1-(2-prop-1-ynylcyclopenten-1-yl)-4-trimethylsilylpent-2-yn-1-ol |
| SMILES | CC#CC1=C(C(O)C#CC(C)(C)[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C17H26OSi/c1-7-9-14-10-8-11-15(14)16(18)12-13-17(2,3)19(4,5)6/h16,18H,8,10-11H2,1-6H3 |
| InChIKey | TXGHYTAKAGNBME-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|