C13H26O2Si — CID 10243472
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopent-2-en-1-ol (PubChem CID 10243472) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopent-2-en-1-ol.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10243472 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methylcyclopent-2-en-1-ol |
| SMILES | CC1=C(CO[Si](C)(C)C(C)(C)C)C(O)CC1 |
| InChI | InChI=1S/C13H26O2Si/c1-10-7-8-12(14)11(10)9-15-16(5,6)13(2,3)4/h12,14H,7-9H2,1-6H3 |
| InChIKey | IJWLDMYXVBGQFA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|