C19H40O4Si2 — CID 154707119
[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopenten-1-yl]methanol (PubChem CID 154707119) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopenten-1-yl]methanol.
| Compound Name | [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopenten-1-yl]methanol |
|---|---|
| PubChem CID | 154707119 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopenten-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C(CO)=C1CO |
| InChI | InChI=1S/C19H40O4Si2/c1-18(2,3)24(7,8)22-16-11-17(15(13-21)14(16)12-20)23-25(9,10)19(4,5)6/h16-17,20-21H,11-13H2,1-10H3/t16-,17+ |
| InChIKey | NCNQGINEHSPBJI-CALCHBBNSA-N |
| XLogP | 4.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|