C14H20OSi — CID 134884576
1-(2-ethynylcyclopenten-1-yl)-4-trimethylsilylbut-2-yn-1-ol (PubChem CID 134884576) has the molecular formula C14H20OSi and a molecular weight of 232.40 g/mol. Its IUPAC name is 1-(2-ethynylcyclopenten-1-yl)-4-trimethylsilylbut-2-yn-1-ol.
| Compound Name | 1-(2-ethynylcyclopenten-1-yl)-4-trimethylsilylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 134884576 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(2-ethynylcyclopenten-1-yl)-4-trimethylsilylbut-2-yn-1-ol |
| SMILES | C#CC1=C(C(O)C#CC[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C14H20OSi/c1-5-12-8-6-9-13(12)14(15)10-7-11-16(2,3)4/h1,14-15H,6,8-9,11H2,2-4H3 |
| InChIKey | LFZKCVKBMUJSTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|