C15H26O2Si — CID 10967467
(1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-ol (PubChem CID 10967467) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-ol.
| Compound Name | (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 10967467 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (1R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-4-methylcyclohex-3-en-1-ol |
| SMILES | C#CC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O)C1 |
| InChI | InChI=1S/C15H26O2Si/c1-8-12-9-13(16)10-14(11(12)2)17-18(6,7)15(3,4)5/h1,13-14,16H,9-10H2,2-7H3/t13-,14+/m1/s1 |
| InChIKey | RFSMRNNKLKAWHP-KGLIPLIRSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|