C9H12O2 — CID 10103340
(1R,3R)-5-ethynyl-4-methylcyclohex-4-ene-1,3-diol (PubChem CID 10103340) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1R,3R)-5-ethynyl-4-methylcyclohex-4-ene-1,3-diol.
| Compound Name | (1R,3R)-5-ethynyl-4-methylcyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 10103340 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1R,3R)-5-ethynyl-4-methylcyclohex-4-ene-1,3-diol |
| SMILES | C#CC1=C(C)[C@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C9H12O2/c1-3-7-4-8(10)5-9(11)6(7)2/h1,8-11H,4-5H2,2H3/t8-,9-/m1/s1 |
| InChIKey | YTQXBFPIJJRLRZ-RKDXNWHRSA-N |
| XLogP | 0.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|