C11H14O3 — CID 10241726
[(1R,5R)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] acetate (PubChem CID 10241726) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is [(1R,5R)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,5R)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10241726 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(1R,5R)-3-ethynyl-5-hydroxy-4-methylcyclohex-3-en-1-yl] acetate |
| SMILES | C#CC1=C(C)[C@H](O)C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C11H14O3/c1-4-9-5-10(14-8(3)12)6-11(13)7(9)2/h1,10-11,13H,5-6H2,2-3H3/t10-,11-/m1/s1 |
| InChIKey | AEQAHUJUJFRGQZ-GHMZBOCLSA-N |
| XLogP | 1.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|