C26H44OSi — CID 134884962
4-butyl-1-(2-hex-1-ynylcyclopenten-1-yl)-4-trimethylsilyloct-2-yn-1-ol (PubChem CID 134884962) has the molecular formula C26H44OSi and a molecular weight of 400.72 g/mol. Its IUPAC name is 4-butyl-1-(2-hex-1-ynylcyclopenten-1-yl)-4-trimethylsilyloct-2-yn-1-ol.
| Compound Name | 4-butyl-1-(2-hex-1-ynylcyclopenten-1-yl)-4-trimethylsilyloct-2-yn-1-ol |
|---|---|
| PubChem CID | 134884962 |
| Molecular Formula | C26H44OSi |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | 4-butyl-1-(2-hex-1-ynylcyclopenten-1-yl)-4-trimethylsilyloct-2-yn-1-ol |
| SMILES | CCCCC#CC1=C(C(O)C#CC(CCCC)(CCCC)[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C26H44OSi/c1-7-10-13-14-16-23-17-15-18-24(23)25(27)19-22-26(20-11-8-2,21-12-9-3)28(4,5)6/h25,27H,7-13,15,17-18,20-21H2,1-6H3 |
| InChIKey | YDYHRNZVFDQGIC-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|