C26H42OSi2 — CID 11101999
(1R,2S)-2-[tert-butyl(dimethyl)silyl]-1-[2-[2-(cyclohexen-1-yl)ethynyl]cyclopenten-1-yl]-4-trimethylsilylbut-3-yn-1-ol (PubChem CID 11101999) has the molecular formula C26H42OSi2 and a molecular weight of 426.79 g/mol. Its IUPAC name is (1R,2S)-2-[tert-butyl(dimethyl)silyl]-1-[2-[2-(cyclohexen-1-yl)ethynyl]cyclopenten-1-yl]-4-trimethylsilylbut-3-yn-1-ol.
| Compound Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]-1-[2-[2-(cyclohexen-1-yl)ethynyl]cyclopenten-1-yl]-4-trimethylsilylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 11101999 |
| Molecular Formula | C26H42OSi2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (1R,2S)-2-[tert-butyl(dimethyl)silyl]-1-[2-[2-(cyclohexen-1-yl)ethynyl]cyclopenten-1-yl]-4-trimethylsilylbut-3-yn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H](C#C[Si](C)(C)C)[C@H](O)C1=C(C#CC2=CCCCC2)CCC1 |
| InChI | InChI=1S/C26H42OSi2/c1-26(2,3)29(7,8)24(19-20-28(4,5)6)25(27)23-16-12-15-22(23)18-17-21-13-10-9-11-14-21/h13,24-25,27H,9-12,14-16H2,1-8H3/t24-,25+/m0/s1 |
| InChIKey | JEOKNXQLJJQFIQ-LOSJGSFVSA-N |
| XLogP | 7.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|