C14H24OSi — CID 11665861
(1R)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol (PubChem CID 11665861) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is (1R)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol.
| Compound Name | (1R)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11665861 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1R)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol |
| SMILES | CC1=C(C#C[Si](C)(C)C)C(C)(C)CC[C@H]1O |
| InChI | InChI=1S/C14H24OSi/c1-11-12(8-10-16(4,5)6)14(2,3)9-7-13(11)15/h13,15H,7,9H2,1-6H3/t13-/m1/s1 |
| InChIKey | ZDJYNZKYXACXSF-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|