C24H40OSi — CID 25139389
1-[2-[2-tri(propan-2-yl)silylethynyl]cyclohexen-1-yl]hept-2-yn-1-ol (PubChem CID 25139389) has the molecular formula C24H40OSi and a molecular weight of 372.67 g/mol. Its IUPAC name is 1-[2-[2-tri(propan-2-yl)silylethynyl]cyclohexen-1-yl]hept-2-yn-1-ol.
| Compound Name | 1-[2-[2-tri(propan-2-yl)silylethynyl]cyclohexen-1-yl]hept-2-yn-1-ol |
|---|---|
| PubChem CID | 25139389 |
| Molecular Formula | C24H40OSi |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 1-[2-[2-tri(propan-2-yl)silylethynyl]cyclohexen-1-yl]hept-2-yn-1-ol |
| SMILES | CCCCC#CC(O)C1=C(C#C[Si](C(C)C)(C(C)C)C(C)C)CCCC1 |
| InChI | InChI=1S/C24H40OSi/c1-8-9-10-11-16-24(25)23-15-13-12-14-22(23)17-18-26(19(2)3,20(4)5)21(6)7/h19-21,24-25H,8-10,12-15H2,1-7H3 |
| InChIKey | ZWSGADCMBZBUMS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|