C25H46OSi — CID 141399555
(3S,4E,15Z)-1-trimethylsilyldocosa-4,15-dien-1-yn-3-ol (PubChem CID 141399555) has the molecular formula C25H46OSi and a molecular weight of 390.73 g/mol. Its IUPAC name is (3S,4E,15Z)-1-trimethylsilyldocosa-4,15-dien-1-yn-3-ol.
| Compound Name | (3S,4E,15Z)-1-trimethylsilyldocosa-4,15-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 141399555 |
| Molecular Formula | C25H46OSi |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | (3S,4E,15Z)-1-trimethylsilyldocosa-4,15-dien-1-yn-3-ol |
| SMILES | CCCCCC/C=C\CCCCCCCCC/C=C/[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C25H46OSi/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(26)23-24-27(2,3)4/h10-11,21-22,25-26H,5-9,12-20H2,1-4H3/b11-10-,22-21+/t25-/m0/s1 |
| InChIKey | FPKXEYNSYFSDBU-QAAJCQCRSA-N |
| XLogP | 7.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|