C18H30OSi — CID 10891604
(3E,5E,7R,9Z)-1-trimethylsilylpentadeca-3,5,9-trien-1-yn-7-ol (PubChem CID 10891604) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is (3E,5E,7R,9Z)-1-trimethylsilylpentadeca-3,5,9-trien-1-yn-7-ol.
| Compound Name | (3E,5E,7R,9Z)-1-trimethylsilylpentadeca-3,5,9-trien-1-yn-7-ol |
|---|---|
| PubChem CID | 10891604 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (3E,5E,7R,9Z)-1-trimethylsilylpentadeca-3,5,9-trien-1-yn-7-ol |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30OSi/c1-5-6-7-8-9-12-15-18(19)16-13-10-11-14-17-20(2,3)4/h9-13,16,18-19H,5-8,15H2,1-4H3/b11-10+,12-9-,16-13+/t18-/m1/s1 |
| InChIKey | KDPHRODBNIWNJK-LGQDTZPNSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|