C21H36F2OSi — CID 10690558
(5E,7E)-3,3-difluoro-1-tri(propan-2-yl)silyldodeca-5,7-dien-1-yn-4-ol (PubChem CID 10690558) has the molecular formula C21H36F2OSi and a molecular weight of 370.60 g/mol. Its IUPAC name is (5E,7E)-3,3-difluoro-1-tri(propan-2-yl)silyldodeca-5,7-dien-1-yn-4-ol.
| Compound Name | (5E,7E)-3,3-difluoro-1-tri(propan-2-yl)silyldodeca-5,7-dien-1-yn-4-ol |
|---|---|
| PubChem CID | 10690558 |
| Molecular Formula | C21H36F2OSi |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (5E,7E)-3,3-difluoro-1-tri(propan-2-yl)silyldodeca-5,7-dien-1-yn-4-ol |
| SMILES | CCCC/C=C/C=C/C(O)C(F)(F)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36F2OSi/c1-8-9-10-11-12-13-14-20(24)21(22,23)15-16-25(17(2)3,18(4)5)19(6)7/h11-14,17-20,24H,8-10H2,1-7H3/b12-11+,14-13+ |
| InChIKey | KSEPZOGEECKKID-LDHFCIDVSA-N |
| XLogP | 6.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|