C16H28F2OSi — CID 15495757
(E)-3,3-difluoro-1-tri(propan-2-yl)silylhept-5-en-1-yn-4-ol (PubChem CID 15495757) has the molecular formula C16H28F2OSi and a molecular weight of 302.48 g/mol. Its IUPAC name is (E)-3,3-difluoro-1-tri(propan-2-yl)silylhept-5-en-1-yn-4-ol.
| Compound Name | (E)-3,3-difluoro-1-tri(propan-2-yl)silylhept-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 15495757 |
| Molecular Formula | C16H28F2OSi |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (E)-3,3-difluoro-1-tri(propan-2-yl)silylhept-5-en-1-yn-4-ol |
| SMILES | C/C=C/C(O)C(F)(F)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H28F2OSi/c1-8-9-15(19)16(17,18)10-11-20(12(2)3,13(4)5)14(6)7/h8-9,12-15,19H,1-7H3/b9-8+ |
| InChIKey | YNWSYUMJKJLWAC-CMDGGOBGSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|