C26H51BOSi — CID 134999914
[(1E,3Z,5S,7Z)-1-[bis(3-methylbutan-2-yl)boranyl]deca-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134999914) has the molecular formula C26H51BOSi and a molecular weight of 418.59 g/mol. Its IUPAC name is [(1E,3Z,5S,7Z)-1-[bis(3-methylbutan-2-yl)boranyl]deca-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1E,3Z,5S,7Z)-1-[bis(3-methylbutan-2-yl)boranyl]deca-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134999914 |
| Molecular Formula | C26H51BOSi |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | [(1E,3Z,5S,7Z)-1-[bis(3-methylbutan-2-yl)boranyl]deca-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC/C=C\C[C@@H](/C=C\C=C\B(C(C)C(C)C)C(C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H51BOSi/c1-13-14-15-18-25(28-29(11,12)26(8,9)10)19-16-17-20-27(23(6)21(2)3)24(7)22(4)5/h14-17,19-25H,13,18H2,1-12H3/b15-14-,19-16-,20-17+/t23?,24?,25-/m0/s1 |
| InChIKey | UWIVTQLBXUJNHW-PCHXSFOCSA-N |
| XLogP | 8.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|