C19H36OSi — CID 138970957
tert-butyl-dimethyl-[(3S,4R,5E,7E)-4,6,7-trimethyldeca-5,7,9-trien-3-yl]oxysilane (PubChem CID 138970957) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R,5E,7E)-4,6,7-trimethyldeca-5,7,9-trien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R,5E,7E)-4,6,7-trimethyldeca-5,7,9-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 138970957 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R,5E,7E)-4,6,7-trimethyldeca-5,7,9-trien-3-yl]oxysilane |
| SMILES | C=C/C=C(C)/C(C)=C/[C@@H](C)[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi/c1-11-13-15(3)16(4)14-17(5)18(12-2)20-21(9,10)19(6,7)8/h11,13-14,17-18H,1,12H2,2-10H3/b15-13+,16-14+/t17-,18+/m1/s1 |
| InChIKey | VEFFAAGZPLAHSY-MTSYIRKZSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|