C13H26OSi — CID 102506721
(3R,4S,5E,7E)-4,6-dimethyl-8-trimethylsilylocta-5,7-dien-3-ol (PubChem CID 102506721) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (3R,4S,5E,7E)-4,6-dimethyl-8-trimethylsilylocta-5,7-dien-3-ol.
| Compound Name | (3R,4S,5E,7E)-4,6-dimethyl-8-trimethylsilylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 102506721 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (3R,4S,5E,7E)-4,6-dimethyl-8-trimethylsilylocta-5,7-dien-3-ol |
| SMILES | CC[C@@H](O)[C@@H](C)/C=C(C)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-7-13(14)12(3)10-11(2)8-9-15(4,5)6/h8-10,12-14H,7H2,1-6H3/b9-8+,11-10+/t12-,13+/m0/s1 |
| InChIKey | SWSGWRRAWMRFCE-SHDASSSZSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|