C22H40O2Si — CID 102384622
tert-butyl-dimethyl-[(2E,4R,5R,6E,8E)-3,5,7-trimethyl-10-(2-methyloxiran-2-yl)deca-2,6,8-trien-4-yl]oxysilane (PubChem CID 102384622) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4R,5R,6E,8E)-3,5,7-trimethyl-10-(2-methyloxiran-2-yl)deca-2,6,8-trien-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2E,4R,5R,6E,8E)-3,5,7-trimethyl-10-(2-methyloxiran-2-yl)deca-2,6,8-trien-4-yl]oxysilane |
|---|---|
| PubChem CID | 102384622 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4R,5R,6E,8E)-3,5,7-trimethyl-10-(2-methyloxiran-2-yl)deca-2,6,8-trien-4-yl]oxysilane |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C=C/CC1(C)CO1 |
| InChI | InChI=1S/C22H40O2Si/c1-11-18(3)20(24-25(9,10)21(5,6)7)19(4)15-17(2)13-12-14-22(8)16-23-22/h11-13,15,19-20H,14,16H2,1-10H3/b13-12+,17-15+,18-11+/t19-,20+,22?/m1/s1 |
| InChIKey | GVEXBAKWUWXMDM-XVAJKCJYSA-N |
| XLogP | 6.66 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|