C17H34OSi — CID 11254568
tert-butyl-dimethyl-[(3R,4S,5Z)-2,4,7-trimethylocta-5,7-dien-3-yl]oxysilane (PubChem CID 11254568) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3R,4S,5Z)-2,4,7-trimethylocta-5,7-dien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3R,4S,5Z)-2,4,7-trimethylocta-5,7-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11254568 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-dimethyl-[(3R,4S,5Z)-2,4,7-trimethylocta-5,7-dien-3-yl]oxysilane |
| SMILES | C=C(C)/C=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H34OSi/c1-13(2)11-12-15(5)16(14(3)4)18-19(9,10)17(6,7)8/h11-12,14-16H,1H2,2-10H3/b12-11-/t15-,16+/m0/s1 |
| InChIKey | CPXJFNDSBSTOEN-YSANFCEKSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|