C24H46O2Si — CID 11165341
(2Z,4R,6E,8E,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4,8,10-trimethyltrideca-2,6,8-trien-1-ol (PubChem CID 11165341) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (2Z,4R,6E,8E,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4,8,10-trimethyltrideca-2,6,8-trien-1-ol.
| Compound Name | (2Z,4R,6E,8E,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4,8,10-trimethyltrideca-2,6,8-trien-1-ol |
|---|---|
| PubChem CID | 11165341 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (2Z,4R,6E,8E,10R,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4,8,10-trimethyltrideca-2,6,8-trien-1-ol |
| SMILES | CC/C(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)[C@H](CC)O[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C24H46O2Si/c1-11-22(18-25)17-20(4)15-13-14-19(3)16-21(5)23(12-2)26-27(9,10)24(6,7)8/h13-14,16-17,20-21,23,25H,11-12,15,18H2,1-10H3/b14-13+,19-16+,22-17-/t20-,21-,23+/m1/s1 |
| InChIKey | FXPDSJMXCMCXTC-BUWYBFMZSA-N |
| XLogP | 7.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|