C20H36OSi — CID 132938840
tert-butyl-[(6S,9E)-2,10-dimethyldodeca-3,4,9,11-tetraen-6-yl]oxy-dimethylsilane (PubChem CID 132938840) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is tert-butyl-[(6S,9E)-2,10-dimethyldodeca-3,4,9,11-tetraen-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(6S,9E)-2,10-dimethyldodeca-3,4,9,11-tetraen-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 132938840 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | tert-butyl-[(6S,9E)-2,10-dimethyldodeca-3,4,9,11-tetraen-6-yl]oxy-dimethylsilane |
| SMILES | C=C/C(C)=C/CC[C@@H](C=C=CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36OSi/c1-10-18(4)14-12-16-19(15-11-13-17(2)3)21-22(8,9)20(5,6)7/h10,13-15,17,19H,1,12,16H2,2-9H3/b18-14+/t11?,19-/m1/s1 |
| InChIKey | JAVQPCHPXRCQTR-YVMNPGJGSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|