C22H40O2Si — CID 135014004
(3E,5S,6S,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8,10-tetramethyldodeca-3,7,9,11-tetraen-1-ol (PubChem CID 135014004) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (3E,5S,6S,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8,10-tetramethyldodeca-3,7,9,11-tetraen-1-ol.
| Compound Name | (3E,5S,6S,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8,10-tetramethyldodeca-3,7,9,11-tetraen-1-ol |
|---|---|
| PubChem CID | 135014004 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (3E,5S,6S,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-3,6,8,10-tetramethyldodeca-3,7,9,11-tetraen-1-ol |
| SMILES | C=C/C(C)=C\C(C)=C/[C@H](C)[C@@H](/C=C(\C)CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-11-17(2)14-19(4)15-20(5)21(16-18(3)12-13-23)24-25(9,10)22(6,7)8/h11,14-16,20-21,23H,1,12-13H2,2-10H3/b17-14-,18-16+,19-15-/t20-,21+/m0/s1 |
| InChIKey | VGBNYZJFGDFIOR-IUSUBDQTSA-N |
| XLogP | 6.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|