C23H42O3Si — CID 46180292
(2E,4Z,6Z,8S,9S,10E)-13-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10-tetraene-1,9-diol (PubChem CID 46180292) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is (2E,4Z,6Z,8S,9S,10E)-13-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10-tetraene-1,9-diol.
| Compound Name | (2E,4Z,6Z,8S,9S,10E)-13-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10-tetraene-1,9-diol |
|---|---|
| PubChem CID | 46180292 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (2E,4Z,6Z,8S,9S,10E)-13-[tert-butyl(dimethyl)silyl]oxy-4,6,8,11-tetramethyltrideca-2,4,6,10-tetraene-1,9-diol |
| SMILES | CC(=C/[C@H](C)[C@H](O)/C=C(\C)CCO[Si](C)(C)C(C)(C)C)/C=C(C)\C=C\CO |
| InChI | InChI=1S/C23H42O3Si/c1-18(11-10-13-24)15-20(3)16-21(4)22(25)17-19(2)12-14-26-27(8,9)23(5,6)7/h10-11,15-17,21-22,24-25H,12-14H2,1-9H3/b11-10+,18-15-,19-17+,20-16-/t21-,22+/m0/s1 |
| InChIKey | FHJJFTMEWSMEHK-RXTZCRRRSA-N |
| XLogP | 5.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|