C25H53IO2Si2 — CID 11489978
tert-butyl-[(E,3S,5S)-1-iodo-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-en-3-yl]oxy-dimethylsilane (PubChem CID 11489978) has the molecular formula C25H53IO2Si2 and a molecular weight of 568.77 g/mol. Its IUPAC name is tert-butyl-[(E,3S,5S)-1-iodo-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S,5S)-1-iodo-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11489978 |
| Molecular Formula | C25H53IO2Si2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | tert-butyl-[(E,3S,5S)-1-iodo-4,4-dimethyl-5-tri(propan-2-yl)silyloxyoct-6-en-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)[C@H](CCI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H53IO2Si2/c1-15-16-22(28-30(19(2)3,20(4)5)21(6)7)25(11,12)23(17-18-26)27-29(13,14)24(8,9)10/h15-16,19-23H,17-18H2,1-14H3/b16-15+/t22-,23-/m0/s1 |
| InChIKey | OPTIRVSCHCADIN-DWLLYVLZSA-N |
| XLogP | 9.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|