C14H27IOSi — CID 131747683
tert-butyl-(3-iodo-6,6-dimethylcyclohex-2-en-1-yl)oxy-dimethylsilane (PubChem CID 131747683) has the molecular formula C14H27IOSi and a molecular weight of 366.36 g/mol. Its IUPAC name is tert-butyl-(3-iodo-6,6-dimethylcyclohex-2-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(3-iodo-6,6-dimethylcyclohex-2-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 131747683 |
| Molecular Formula | C14H27IOSi |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | tert-butyl-(3-iodo-6,6-dimethylcyclohex-2-en-1-yl)oxy-dimethylsilane |
| SMILES | CC1(C)CCC(I)=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27IOSi/c1-13(2,3)17(6,7)16-12-10-11(15)8-9-14(12,4)5/h10,12H,8-9H2,1-7H3 |
| InChIKey | KCGNKPDHRURSNA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|