C18H34OSi — CID 53472948
tert-butyl-[(1E,3R)-1-cyclopropyl-4,4-dimethylhepta-1,6-dien-3-yl]oxy-dimethylsilane (PubChem CID 53472948) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[(1E,3R)-1-cyclopropyl-4,4-dimethylhepta-1,6-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3R)-1-cyclopropyl-4,4-dimethylhepta-1,6-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 53472948 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[(1E,3R)-1-cyclopropyl-4,4-dimethylhepta-1,6-dien-3-yl]oxy-dimethylsilane |
| SMILES | C=CCC(C)(C)[C@@H](/C=C/C1CC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-9-14-18(5,6)16(13-12-15-10-11-15)19-20(7,8)17(2,3)4/h9,12-13,15-16H,1,10-11,14H2,2-8H3/b13-12+/t16-/m1/s1 |
| InChIKey | CQBXUNKIZASRGP-CJTWTEFWSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|