C19H36OSi — CID 134844444
tert-butyl-[1-[(2E)-5,5-dimethylocta-2,7-dien-2-yl]cyclopropyl]oxy-dimethylsilane (PubChem CID 134844444) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is tert-butyl-[1-[(2E)-5,5-dimethylocta-2,7-dien-2-yl]cyclopropyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[(2E)-5,5-dimethylocta-2,7-dien-2-yl]cyclopropyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134844444 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl-[1-[(2E)-5,5-dimethylocta-2,7-dien-2-yl]cyclopropyl]oxy-dimethylsilane |
| SMILES | C=CCC(C)(C)C/C=C(\C)C1(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36OSi/c1-10-12-18(6,7)13-11-16(2)19(14-15-19)20-21(8,9)17(3,4)5/h10-11H,1,12-15H2,2-9H3/b16-11+ |
| InChIKey | CJSXJCIERALERU-LFIBNONCSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|