C19H38OSi — CID 15441003
[(3Z)-5-tert-butyl-2,6-dimethylhepta-3,5-dien-2-yl]oxy-triethylsilane (PubChem CID 15441003) has the molecular formula C19H38OSi and a molecular weight of 310.60 g/mol. Its IUPAC name is [(3Z)-5-tert-butyl-2,6-dimethylhepta-3,5-dien-2-yl]oxy-triethylsilane.
| Compound Name | [(3Z)-5-tert-butyl-2,6-dimethylhepta-3,5-dien-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 15441003 |
| Molecular Formula | C19H38OSi |
| Molecular Weight | 310.60 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | [(3Z)-5-tert-butyl-2,6-dimethylhepta-3,5-dien-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)/C=C\C(=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38OSi/c1-11-21(12-2,13-3)20-19(9,10)15-14-17(16(4)5)18(6,7)8/h14-15H,11-13H2,1-10H3/b15-14- |
| InChIKey | IPSMFPGEOMQDEW-PFONDFGASA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|