C18H34OSi — CID 134963682
tert-butyl-[1-[(2Z)-5,5-dimethylhepta-2,6-dien-2-yl]cyclopropyl]oxy-dimethylsilane (PubChem CID 134963682) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[1-[(2Z)-5,5-dimethylhepta-2,6-dien-2-yl]cyclopropyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[(2Z)-5,5-dimethylhepta-2,6-dien-2-yl]cyclopropyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134963682 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[1-[(2Z)-5,5-dimethylhepta-2,6-dien-2-yl]cyclopropyl]oxy-dimethylsilane |
| SMILES | C=CC(C)(C)C/C=C(/C)C1(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H34OSi/c1-10-17(6,7)12-11-15(2)18(13-14-18)19-20(8,9)16(3,4)5/h10-11H,1,12-14H2,2-9H3/b15-11- |
| InChIKey | NOQNAEQATBWVJY-PTNGSMBKSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|