C20H34OSi — CID 24755646
tert-butyl-dimethyl-[(E,5S)-4,4,7-trimethylundec-6-en-1,10-diyn-5-yl]oxysilane (PubChem CID 24755646) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,5S)-4,4,7-trimethylundec-6-en-1,10-diyn-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,5S)-4,4,7-trimethylundec-6-en-1,10-diyn-5-yl]oxysilane |
|---|---|
| PubChem CID | 24755646 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | tert-butyl-dimethyl-[(E,5S)-4,4,7-trimethylundec-6-en-1,10-diyn-5-yl]oxysilane |
| SMILES | C#CCC/C(C)=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)CC#C |
| InChI | InChI=1S/C20H34OSi/c1-11-13-14-17(3)16-18(20(7,8)15-12-2)21-22(9,10)19(4,5)6/h1-2,16,18H,13-15H2,3-10H3/b17-16+/t18-/m0/s1 |
| InChIKey | YCDSABODHXVHBU-GVJQPLCZSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|