C17H30OSi — CID 11300426
[(4S)-5-[(2R,6R)-6-ethenyl-3,6-dihydro-2H-pyran-2-yl]-4-methyl-2-methylidenepentyl]-trimethylsilane (PubChem CID 11300426) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is [(4S)-5-[(2R,6R)-6-ethenyl-3,6-dihydro-2H-pyran-2-yl]-4-methyl-2-methylidenepentyl]-trimethylsilane.
| Compound Name | [(4S)-5-[(2R,6R)-6-ethenyl-3,6-dihydro-2H-pyran-2-yl]-4-methyl-2-methylidenepentyl]-trimethylsilane |
|---|---|
| PubChem CID | 11300426 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [(4S)-5-[(2R,6R)-6-ethenyl-3,6-dihydro-2H-pyran-2-yl]-4-methyl-2-methylidenepentyl]-trimethylsilane |
| SMILES | C=C[C@@H]1C=CC[C@@H](C[C@@H](C)CC(=C)C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H30OSi/c1-7-16-9-8-10-17(18-16)12-14(2)11-15(3)13-19(4,5)6/h7-9,14,16-17H,1,3,10-13H2,2,4-6H3/t14-,16+,17-/m0/s1 |
| InChIKey | KVAVPJVXFUDMKH-UAGQMJEPSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|