C15H28OSi — CID 135041561
trimethyl-[(E)-[(2S,6S)-2-[(E)-prop-1-enyl]-6-propyloxan-4-ylidene]methyl]silane (PubChem CID 135041561) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is trimethyl-[(E)-[(2S,6S)-2-[(E)-prop-1-enyl]-6-propyloxan-4-ylidene]methyl]silane.
| Compound Name | trimethyl-[(E)-[(2S,6S)-2-[(E)-prop-1-enyl]-6-propyloxan-4-ylidene]methyl]silane |
|---|---|
| PubChem CID | 135041561 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | trimethyl-[(E)-[(2S,6S)-2-[(E)-prop-1-enyl]-6-propyloxan-4-ylidene]methyl]silane |
| SMILES | C/C=C/[C@@H]1C/C(=C/[Si](C)(C)C)C[C@H](CCC)O1 |
| InChI | InChI=1S/C15H28OSi/c1-6-8-14-10-13(12-17(3,4)5)11-15(16-14)9-7-2/h6,8,12,14-15H,7,9-11H2,1-5H3/b8-6+,13-12-/t14-,15+/m1/s1 |
| InChIKey | LMPPFJIXLIFHDR-NKQMZDKJSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|