C12H20O — CID 10877737
6-butyl-5-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 10877737) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 6-butyl-5-prop-2-enyl-3,6-dihydro-2H-pyran.
| Compound Name | 6-butyl-5-prop-2-enyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10877737 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 6-butyl-5-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CCC1=CCCOC1CCCC |
| InChI | InChI=1S/C12H20O/c1-3-5-9-12-11(7-4-2)8-6-10-13-12/h4,8,12H,2-3,5-7,9-10H2,1H3 |
| InChIKey | OISMRJSKJDXAAP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|