C10H16O — CID 163015296
(2R)-3-methyl-2-(3-methylbut-3-enyl)-2,5-dihydrofuran (PubChem CID 163015296) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2R)-3-methyl-2-(3-methylbut-3-enyl)-2,5-dihydrofuran.
| Compound Name | (2R)-3-methyl-2-(3-methylbut-3-enyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 163015296 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2R)-3-methyl-2-(3-methylbut-3-enyl)-2,5-dihydrofuran |
| SMILES | C=C(C)CC[C@H]1OCC=C1C |
| InChI | InChI=1S/C10H16O/c1-8(2)4-5-10-9(3)6-7-11-10/h6,10H,1,4-5,7H2,2-3H3/t10-/m1/s1 |
| InChIKey | YCDULPVXDZNTND-SNVBAGLBSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|