C17H30OSi — CID 135022516
2-[(7S)-7-hexyl-2,3,4,7-tetrahydrooxepin-2-yl]ethynyl-trimethylsilane (PubChem CID 135022516) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is 2-[(7S)-7-hexyl-2,3,4,7-tetrahydrooxepin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(7S)-7-hexyl-2,3,4,7-tetrahydrooxepin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 135022516 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[(7S)-7-hexyl-2,3,4,7-tetrahydrooxepin-2-yl]ethynyl-trimethylsilane |
| SMILES | CCCCCC[C@H]1C=CCCC(C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H30OSi/c1-5-6-7-8-11-16-12-9-10-13-17(18-16)14-15-19(2,3)4/h9,12,16-17H,5-8,10-11,13H2,1-4H3/t16-,17?/m0/s1 |
| InChIKey | AWFRBIURVJIBSR-BHWOMJMDSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|