C17H30OSi — CID 135042397
2-[(5Z)-9-butyl-2,3,4,7,8,9-hexahydrooxonin-2-yl]ethynyl-trimethylsilane (PubChem CID 135042397) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is 2-[(5Z)-9-butyl-2,3,4,7,8,9-hexahydrooxonin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(5Z)-9-butyl-2,3,4,7,8,9-hexahydrooxonin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 135042397 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[(5Z)-9-butyl-2,3,4,7,8,9-hexahydrooxonin-2-yl]ethynyl-trimethylsilane |
| SMILES | CCCCC1CC/C=C\CCC(C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H30OSi/c1-5-6-11-16-12-9-7-8-10-13-17(18-16)14-15-19(2,3)4/h7-8,16-17H,5-6,9-13H2,1-4H3/b8-7- |
| InChIKey | JZJCTVBQESQIPM-FPLPWBNLSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|