C22H38O — CID 102083481
(2R,5S)-2-butyl-5-[(E)-tetradec-3-en-1-ynyl]oxolane (PubChem CID 102083481) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (2R,5S)-2-butyl-5-[(E)-tetradec-3-en-1-ynyl]oxolane.
| Compound Name | (2R,5S)-2-butyl-5-[(E)-tetradec-3-en-1-ynyl]oxolane |
|---|---|
| PubChem CID | 102083481 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (2R,5S)-2-butyl-5-[(E)-tetradec-3-en-1-ynyl]oxolane |
| SMILES | CCCCCCCCCC/C=C/C#C[C@@H]1CC[C@@H](CCCC)O1 |
| InChI | InChI=1S/C22H38O/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-22-20-19-21(23-22)17-6-4-2/h14-15,21-22H,3-13,17,19-20H2,1-2H3/b15-14+/t21-,22-/m1/s1 |
| InChIKey | AQYUETQWYIYYJP-UQECUQMJSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|