C21H31BrO3 — CID 73300751
methyl 4-[5-(12-bromododeca-3,11-dien-1-ynyl)oxolan-2-yl]butanoate (PubChem CID 73300751) has the molecular formula C21H31BrO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is methyl 4-[5-(12-bromododeca-3,11-dien-1-ynyl)oxolan-2-yl]butanoate.
| Compound Name | methyl 4-[5-(12-bromododeca-3,11-dien-1-ynyl)oxolan-2-yl]butanoate |
|---|---|
| PubChem CID | 73300751 |
| Molecular Formula | C21H31BrO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl 4-[5-(12-bromododeca-3,11-dien-1-ynyl)oxolan-2-yl]butanoate |
| SMILES | COC(=O)CCCC1CCC(C#CC=CCCCCCCC=CBr)O1 |
| InChI | InChI=1S/C21H31BrO3/c1-24-21(23)15-12-14-20-17-16-19(25-20)13-10-8-6-4-2-3-5-7-9-11-18-22/h6,8,11,18-20H,2-5,7,9,12,14-17H2,1H3 |
| InChIKey | ATHZZRJFORDQAQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|