C15H24O — CID 11641936
(2R,6Z,8S)-2-ethyl-8-hexyl-1-oxacyclooct-6-en-3-yne (PubChem CID 11641936) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,6Z,8S)-2-ethyl-8-hexyl-1-oxacyclooct-6-en-3-yne.
| Compound Name | (2R,6Z,8S)-2-ethyl-8-hexyl-1-oxacyclooct-6-en-3-yne |
|---|---|
| PubChem CID | 11641936 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2R,6Z,8S)-2-ethyl-8-hexyl-1-oxacyclooct-6-en-3-yne |
| SMILES | CCCCCC[C@H]1/C=C\CC#C[C@@H](CC)O1 |
| InChI | InChI=1S/C15H24O/c1-3-5-6-8-12-15-13-10-7-9-11-14(4-2)16-15/h10,13-15H,3-8,12H2,1-2H3/b13-10-/t14-,15+/m1/s1 |
| InChIKey | ZANLEAABOSBZJU-GHRAKNKNSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|