C17H36OSi2 — CID 10335702
[2-butyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane (PubChem CID 10335702) has the molecular formula C17H36OSi2 and a molecular weight of 312.65 g/mol. Its IUPAC name is [2-butyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane.
| Compound Name | [2-butyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10335702 |
| Molecular Formula | C17H36OSi2 |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [2-butyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane |
| SMILES | CCCCC1CC(C[Si](C)(C)C)=C(C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C17H36OSi2/c1-8-9-10-17-11-15(13-19(2,3)4)16(12-18-17)14-20(5,6)7/h17H,8-14H2,1-7H3 |
| InChIKey | PDUMEXKPZHVIEM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|