C16H34OSi2 — CID 10470002
trimethyl-[[2-propan-2-yl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane (PubChem CID 10470002) has the molecular formula C16H34OSi2 and a molecular weight of 298.62 g/mol. Its IUPAC name is trimethyl-[[2-propan-2-yl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane.
| Compound Name | trimethyl-[[2-propan-2-yl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane |
|---|---|
| PubChem CID | 10470002 |
| Molecular Formula | C16H34OSi2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | trimethyl-[[2-propan-2-yl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane |
| SMILES | CC(C)C1CC(C[Si](C)(C)C)=C(C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C16H34OSi2/c1-13(2)16-9-14(11-18(3,4)5)15(10-17-16)12-19(6,7)8/h13,16H,9-12H2,1-8H3 |
| InChIKey | FIARKBYQSDGBLH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|